C18H15N3O2S2 — CID 20900462
N-(3-acetylphenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide (PubChem CID 20900462) has the molecular formula C18H15N3O2S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide.
| Compound Name | N-(3-acetylphenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 20900462 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-(3-acetylphenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CSc2ccc(-c3cccs3)nn2)c1 |
| InChI | InChI=1S/C18H15N3O2S2/c1-12(22)13-4-2-5-14(10-13)19-17(23)11-25-18-8-7-15(20-21-18)16-6-3-9-24-16/h2-10H,11H2,1H3,(H,19,23) |
| InChIKey | PNADWHBUOOJLLS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |