C16H12BrN3OS2 — CID 20900448
N-(4-bromophenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide (PubChem CID 20900448) has the molecular formula C16H12BrN3OS2 and a molecular weight of 406.33 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide.
| Compound Name | N-(4-bromophenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 20900448 |
| Molecular Formula | C16H12BrN3OS2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | N-(4-bromophenyl)-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(-c2cccs2)nn1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrN3OS2/c17-11-3-5-12(6-4-11)18-15(21)10-23-16-8-7-13(19-20-16)14-2-1-9-22-14/h1-9H,10H2,(H,18,21) |
| InChIKey | VNQYOSIOGBEBPG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |