C12H10BrNOS2 — CID 3334524
N-(4-bromophenyl)-2-thiophen-2-ylsulfanylacetamide (PubChem CID 3334524) has the molecular formula C12H10BrNOS2 and a molecular weight of 328.26 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-thiophen-2-ylsulfanylacetamide.
| Compound Name | N-(4-bromophenyl)-2-thiophen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 3334524 |
| Molecular Formula | C12H10BrNOS2 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | N-(4-bromophenyl)-2-thiophen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1cccs1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H10BrNOS2/c13-9-3-5-10(6-4-9)14-11(15)8-17-12-2-1-7-16-12/h1-7H,8H2,(H,14,15) |
| InChIKey | OMRKZGFACVWIAV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |