C16H20ClN3O2S2 — CID 119500918
N-[2-(methylamino)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide;hydrochloride (PubChem CID 119500918) has the molecular formula C16H20ClN3O2S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119500918 |
| Molecular Formula | C16H20ClN3O2S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[2-(methylamino)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide;hydrochloride |
| SMILES | CNCCNC(=O)c1ccc(NC(=O)CSc2cccs2)cc1.Cl |
| InChI | InChI=1S/C16H19N3O2S2.ClH/c1-17-8-9-18-16(21)12-4-6-13(7-5-12)19-14(20)11-23-15-3-2-10-22-15;/h2-7,10,17H,8-9,11H2,1H3,(H,18,21)(H,19,20);1H |
| InChIKey | JQXYXKQBXKWHDI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|