C19H25N3O2S2 — CID 119640623
N-(2-amino-2-ethylbutyl)-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide (PubChem CID 119640623) has the molecular formula C19H25N3O2S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 119640623 |
| Molecular Formula | C19H25N3O2S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide |
| SMILES | CCC(N)(CC)CNC(=O)c1ccc(NC(=O)CSc2cccs2)cc1 |
| InChI | InChI=1S/C19H25N3O2S2/c1-3-19(20,4-2)13-21-18(24)14-7-9-15(10-8-14)22-16(23)12-26-17-6-5-11-25-17/h5-11H,3-4,12-13,20H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | CWOJSHXOAMLKLM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |