C13H11F3N2OS2 — CID 29295581
N-[4-amino-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylsulfanylacetamide (PubChem CID 29295581) has the molecular formula C13H11F3N2OS2 and a molecular weight of 332.37 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylsulfanylacetamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 29295581 |
| Molecular Formula | C13H11F3N2OS2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylsulfanylacetamide |
| SMILES | Nc1ccc(NC(=O)CSc2cccs2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2OS2/c14-13(15,16)9-6-8(3-4-10(9)17)18-11(19)7-21-12-2-1-5-20-12/h1-6H,7,17H2,(H,18,19) |
| InChIKey | JANLWYKUUCHNHH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|