C20H19N7O2S2 — CID 146146001
N-[2-(6-aminopurin-9-yl)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide (PubChem CID 146146001) has the molecular formula C20H19N7O2S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[2-(6-aminopurin-9-yl)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide.
| Compound Name | N-[2-(6-aminopurin-9-yl)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 146146001 |
| Molecular Formula | C20H19N7O2S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[2-(6-aminopurin-9-yl)ethyl]-4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzamide |
| SMILES | Nc1ncnc2c1ncn2CCNC(=O)c1ccc(NC(=O)CSc2cccs2)cc1 |
| InChI | InChI=1S/C20H19N7O2S2/c21-18-17-19(24-11-23-18)27(12-25-17)8-7-22-20(29)13-3-5-14(6-4-13)26-15(28)10-31-16-2-1-9-30-16/h1-6,9,11-12H,7-8,10H2,(H,22,29)(H,26,28)(H2,21,23,24) |
| InChIKey | HYAVTHMJAHITPK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |