C19H17BrN4OS — CID 53073922
2-[6-(benzylamino)pyridazin-3-yl]sulfanyl-N-(4-bromophenyl)acetamide (PubChem CID 53073922) has the molecular formula C19H17BrN4OS and a molecular weight of 429.34 g/mol. Its IUPAC name is 2-[6-(benzylamino)pyridazin-3-yl]sulfanyl-N-(4-bromophenyl)acetamide.
| Compound Name | 2-[6-(benzylamino)pyridazin-3-yl]sulfanyl-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 53073922 |
| Molecular Formula | C19H17BrN4OS |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-[6-(benzylamino)pyridazin-3-yl]sulfanyl-N-(4-bromophenyl)acetamide |
| SMILES | O=C(CSc1ccc(NCc2ccccc2)nn1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrN4OS/c20-15-6-8-16(9-7-15)22-18(25)13-26-19-11-10-17(23-24-19)21-12-14-4-2-1-3-5-14/h1-11H,12-13H2,(H,21,23)(H,22,25) |
| InChIKey | CSIBWLUBTOUJPK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |