C22H22N4O3S — CID 53073910
ethyl 4-[[2-[6-(benzylamino)pyridazin-3-yl]sulfanylacetyl]amino]benzoate (PubChem CID 53073910) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is ethyl 4-[[2-[6-(benzylamino)pyridazin-3-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[6-(benzylamino)pyridazin-3-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 53073910 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | ethyl 4-[[2-[6-(benzylamino)pyridazin-3-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2ccc(NCc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-2-29-22(28)17-8-10-18(11-9-17)24-20(27)15-30-21-13-12-19(25-26-21)23-14-16-6-4-3-5-7-16/h3-13H,2,14-15H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | LNXSQQZMXJGCJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |