ethane;3-ethenyl-4-(methylamino)benzoic acid

C12H17NO2 — CID 145311632

IUPACethane;3-ethenyl-4-(methylamino)benzoic acid
SMILESC=Cc1cc(C(=O)O)ccc1NC.CC
InChIInChI=1S/C10H11NO2.C2H6/c1-3-7-6-8(10(12)13)4-5-9(7)11-2;1-2/h3-6,11H,1H2,2H3,(H,12,13);1-2H3
InChIKeyBXKCUNALVMXWQV-UHFFFAOYSA-N
MW207.27 g/mol
LogP3.10
Rot. Bonds3

About ethane;3-ethenyl-4-(methylamino)benzoic acid

ethane;3-ethenyl-4-(methylamino)benzoic acid (PubChem CID 145311632) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is ethane;3-ethenyl-4-(methylamino)benzoic acid.

Molecular Properties

Compound Nameethane;3-ethenyl-4-(methylamino)benzoic acid
PubChem CID145311632
Molecular FormulaC12H17NO2
Molecular Weight207.27 g/mol
Exact Mass207.13
IUPAC Nameethane;3-ethenyl-4-(methylamino)benzoic acid
SMILESC=Cc1cc(C(=O)O)ccc1NC.CC
InChIInChI=1S/C10H11NO2.C2H6/c1-3-7-6-8(10(12)13)4-5-9(7)11-2;1-2/h3-6,11H,1H2,2H3,(H,12,13);1-2H3
InChIKeyBXKCUNALVMXWQV-UHFFFAOYSA-N
XLogP3.10
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.27
LogP ≤ 53.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze ethane;3-ethenyl-4-(methylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;3-ethenyl-4-(methylamino)benzoic acid?
The IUPAC name of ethane;3-ethenyl-4-(methylamino)benzoic acid (CID 145311632) is ethane;3-ethenyl-4-(methylamino)benzoic acid.
What is the SMILES notation for ethane;3-ethenyl-4-(methylamino)benzoic acid?
The canonical SMILES for ethane;3-ethenyl-4-(methylamino)benzoic acid is C=Cc1cc(C(=O)O)ccc1NC.CC.
What is the InChIKey of ethane;3-ethenyl-4-(methylamino)benzoic acid?
The InChIKey is BXKCUNALVMXWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.C2H6/c1-3-7-6-8(10(12)13)4-5-9(7)11-2;1-2/h3-6,11H,1H2,2H3,(H,12,13);1-2H3.
What are the key properties of ethane;3-ethenyl-4-(methylamino)benzoic acid?
ethane;3-ethenyl-4-(methylamino)benzoic acid has a molecular weight of 207.27 g/mol, XLogP of 3.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethenyl-4-(methylamino)benzoic acid is sourced from PubChem (CID 145311632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).