C10H14N2 — CID 169168599
2-ethenyl-1-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 169168599) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-ethenyl-1-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-ethenyl-1-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 169168599 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-ethenyl-1-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | C=Cc1cc(NC)ccc1NC |
| InChI | InChI=1S/C10H14N2/c1-4-8-7-9(11-2)5-6-10(8)12-3/h4-7,11-12H,1H2,2-3H3 |
| InChIKey | CFLARKYPTCZUQO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |