C8H11Cl3N4Zn — CID 173436982
zinc;2,5-bis(methylamino)benzenediazonium;trichloride (PubChem CID 173436982) has the molecular formula C8H11Cl3N4Zn and a molecular weight of 334.95 g/mol. Its IUPAC name is zinc;2,5-bis(methylamino)benzenediazonium;trichloride.
| Compound Name | zinc;2,5-bis(methylamino)benzenediazonium;trichloride |
|---|---|
| PubChem CID | 173436982 |
| Molecular Formula | C8H11Cl3N4Zn |
| Molecular Weight | 334.95 g/mol |
| Exact Mass | 331.93 |
| IUPAC Name | zinc;2,5-bis(methylamino)benzenediazonium;trichloride |
| SMILES | CNc1ccc(NC)c([N+]#N)c1.[Cl-].[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C8H10N4.3ClH.Zn/c1-10-6-3-4-7(11-2)8(5-6)12-9;;;;/h3-5,9H,1-2H3;3*1H;/q;;;;+2/p-2 |
| InChIKey | QKLVKKMLUMTELQ-UHFFFAOYSA-L |
| XLogP | -6.74 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.95 |
| LogP ≤ 5 | -6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|