C14H18N2 — CID 139804075
2-N,6-N,1,4-tetramethylnaphthalene-2,6-diamine (PubChem CID 139804075) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-N,6-N,1,4-tetramethylnaphthalene-2,6-diamine.
| Compound Name | 2-N,6-N,1,4-tetramethylnaphthalene-2,6-diamine |
|---|---|
| PubChem CID | 139804075 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-N,6-N,1,4-tetramethylnaphthalene-2,6-diamine |
| SMILES | CNc1ccc2c(C)c(NC)cc(C)c2c1 |
| InChI | InChI=1S/C14H18N2/c1-9-7-14(16-4)10(2)12-6-5-11(15-3)8-13(9)12/h5-8,15-16H,1-4H3 |
| InChIKey | UKWXVGMOQQIBHD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |