C12H14N2 — CID 139601162
1,4-dimethylnaphthalene-2,6-diamine (PubChem CID 139601162) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,4-dimethylnaphthalene-2,6-diamine.
| Compound Name | 1,4-dimethylnaphthalene-2,6-diamine |
|---|---|
| PubChem CID | 139601162 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,4-dimethylnaphthalene-2,6-diamine |
| SMILES | Cc1cc(N)c(C)c2ccc(N)cc12 |
| InChI | InChI=1S/C12H14N2/c1-7-5-12(14)8(2)10-4-3-9(13)6-11(7)10/h3-6H,13-14H2,1-2H3 |
| InChIKey | RWOSSNBHZMVKJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|