C18H16N2 — CID 163838926
3,8-dimethylpyrene-1,6-diamine (PubChem CID 163838926) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3,8-dimethylpyrene-1,6-diamine.
| Compound Name | 3,8-dimethylpyrene-1,6-diamine |
|---|---|
| PubChem CID | 163838926 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3,8-dimethylpyrene-1,6-diamine |
| SMILES | Cc1cc(N)c2ccc3c(C)cc(N)c4ccc1c2c34 |
| InChI | InChI=1S/C18H16N2/c1-9-7-15(19)13-6-4-12-10(2)8-16(20)14-5-3-11(9)17(13)18(12)14/h3-8H,19-20H2,1-2H3 |
| InChIKey | OKESOCNUNCEEGD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|