C19H16O — CID 154487222
3,6,8-trimethylpyren-1-ol (PubChem CID 154487222) has the molecular formula C19H16O and a molecular weight of 260.34 g/mol. Its IUPAC name is 3,6,8-trimethylpyren-1-ol.
| Compound Name | 3,6,8-trimethylpyren-1-ol |
|---|---|
| PubChem CID | 154487222 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3,6,8-trimethylpyren-1-ol |
| SMILES | Cc1cc(C)c2ccc3c(O)cc(C)c4ccc1c2c43 |
| InChI | InChI=1S/C19H16O/c1-10-8-11(2)14-6-7-16-17(20)9-12(3)15-5-4-13(10)18(14)19(15)16/h4-9,20H,1-3H3 |
| InChIKey | UHTPZSPGBGOVJQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|