C18H13NaO — CID 54708780
sodium 1,9-dimethyl-6H-pyren-6-id-4-ol (PubChem CID 54708780) has the molecular formula C18H13NaO and a molecular weight of 268.29 g/mol. Its IUPAC name is sodium 1,9-dimethyl-6H-pyren-6-id-4-ol.
| Compound Name | sodium 1,9-dimethyl-6H-pyren-6-id-4-ol |
|---|---|
| PubChem CID | 54708780 |
| Molecular Formula | C18H13NaO |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | sodium 1,9-dimethyl-6H-pyren-6-id-4-ol |
| SMILES | Cc1cc2c(C)ccc3c(O)cc4[c-]ccc1c4c23.[Na+] |
| InChI | InChI=1S/C18H13O.Na/c1-10-6-7-14-16(19)9-12-4-3-5-13-11(2)8-15(10)18(14)17(12)13;/h3,5-9,19H,1-2H3;/q-1;+1 |
| InChIKey | BVZMVYVMYPHVPU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|