C14H16 — CID 54387778
1,2,4,6-tetramethylnaphthalene (PubChem CID 54387778) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1,2,4,6-tetramethylnaphthalene.
| Compound Name | 1,2,4,6-tetramethylnaphthalene |
|---|---|
| PubChem CID | 54387778 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1,2,4,6-tetramethylnaphthalene |
| SMILES | Cc1ccc2c(C)c(C)cc(C)c2c1 |
| InChI | InChI=1S/C14H16/c1-9-5-6-13-12(4)10(2)8-11(3)14(13)7-9/h5-8H,1-4H3 |
| InChIKey | YHGKZYWIUOZPMT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |