C8H11N4+ — CID 173436983
2,5-bis(methylamino)benzenediazonium (PubChem CID 173436983) has the molecular formula C8H11N4+ and a molecular weight of 163.20 g/mol. Its IUPAC name is 2,5-bis(methylamino)benzenediazonium.
| Compound Name | 2,5-bis(methylamino)benzenediazonium |
|---|---|
| PubChem CID | 173436983 |
| Molecular Formula | C8H11N4+ |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2,5-bis(methylamino)benzenediazonium |
| SMILES | CNc1ccc(NC)c([N+]#N)c1 |
| InChI | InChI=1S/C8H10N4/c1-10-6-3-4-7(11-2)8(5-6)12-9/h3-5,9H,1-2H3/p+1 |
| InChIKey | SXFKHLCRKWUPOG-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|