C27H16F6O5 — CID 145313600
3,6-bis[4-(trifluoromethoxy)phenyl]-9H-fluorene-2,7,9-triol (PubChem CID 145313600) has the molecular formula C27H16F6O5 and a molecular weight of 534.41 g/mol. Its IUPAC name is 3,6-bis[4-(trifluoromethoxy)phenyl]-9H-fluorene-2,7,9-triol.
| Compound Name | 3,6-bis[4-(trifluoromethoxy)phenyl]-9H-fluorene-2,7,9-triol |
|---|---|
| PubChem CID | 145313600 |
| Molecular Formula | C27H16F6O5 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | 3,6-bis[4-(trifluoromethoxy)phenyl]-9H-fluorene-2,7,9-triol |
| SMILES | Oc1cc2c(cc1-c1ccc(OC(F)(F)F)cc1)-c1cc(-c3ccc(OC(F)(F)F)cc3)c(O)cc1C2O |
| InChI | InChI=1S/C27H16F6O5/c28-26(29,30)37-15-5-1-13(2-6-15)17-9-19-20-10-18(14-3-7-16(8-4-14)38-27(31,32)33)24(35)12-22(20)25(36)21(19)11-23(17)34/h1-12,25,34-36H |
| InChIKey | HYARTHBLHKJRME-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |