C8H13N5 — CID 145314905
(E)-N-methyl-1-methylimino-1-(1,2,4-triazol-1-yl)but-2-en-2-amine (PubChem CID 145314905) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is (E)-N-methyl-1-methylimino-1-(1,2,4-triazol-1-yl)but-2-en-2-amine.
| Compound Name | (E)-N-methyl-1-methylimino-1-(1,2,4-triazol-1-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 145314905 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | (E)-N-methyl-1-methylimino-1-(1,2,4-triazol-1-yl)but-2-en-2-amine |
| SMILES | C/C=C(NC)\C(=N/C)n1cncn1 |
| InChI | InChI=1S/C8H13N5/c1-4-7(9-2)8(10-3)13-6-11-5-12-13/h4-6,9H,1-3H3/b7-4+,10-8+ |
| InChIKey | KQNFUNZYQDINMA-DAAQNPAKSA-N |
| XLogP | 0.28 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|