C24H22F4N2O3 — CID 145315236
4-[[6-[2-(2,4-difluorophenyl)-2-ethoxy-1,1-difluoro-2-hydroxyethyl]-3-pyridinyl]oxy]benzonitrile;ethane (PubChem CID 145315236) has the molecular formula C24H22F4N2O3 and a molecular weight of 462.44 g/mol. Its IUPAC name is 4-[[6-[2-(2,4-difluorophenyl)-2-ethoxy-1,1-difluoro-2-hydroxyethyl]-3-pyridinyl]oxy]benzonitrile;ethane.
| Compound Name | 4-[[6-[2-(2,4-difluorophenyl)-2-ethoxy-1,1-difluoro-2-hydroxyethyl]-3-pyridinyl]oxy]benzonitrile;ethane |
|---|---|
| PubChem CID | 145315236 |
| Molecular Formula | C24H22F4N2O3 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 4-[[6-[2-(2,4-difluorophenyl)-2-ethoxy-1,1-difluoro-2-hydroxyethyl]-3-pyridinyl]oxy]benzonitrile;ethane |
| SMILES | CC.CCOC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Oc2ccc(C#N)cc2)cn1 |
| InChI | InChI=1S/C22H16F4N2O3.C2H6/c1-2-30-22(29,18-9-5-15(23)11-19(18)24)21(25,26)20-10-8-17(13-28-20)31-16-6-3-14(12-27)4-7-16;1-2/h3-11,13,29H,2H2,1H3;1-2H3 |
| InChIKey | XWXCIXPPJILUDA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|