C27H25F4N5O4S — CID 139465321
tert-butyl N-[carbamothioyl-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]amino]carbamate (PubChem CID 139465321) has the molecular formula C27H25F4N5O4S and a molecular weight of 591.59 g/mol. Its IUPAC name is tert-butyl N-[carbamothioyl-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]amino]carbamate.
| Compound Name | tert-butyl N-[carbamothioyl-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]amino]carbamate |
|---|---|
| PubChem CID | 139465321 |
| Molecular Formula | C27H25F4N5O4S |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | tert-butyl N-[carbamothioyl-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Oc2ccc(C#N)cc2)cn1)C(N)=S |
| InChI | InChI=1S/C27H25F4N5O4S/c1-25(2,3)40-24(37)35-36(23(33)41)15-26(38,20-10-6-17(28)12-21(20)29)27(30,31)22-11-9-19(14-34-22)39-18-7-4-16(13-32)5-8-18/h4-12,14,38H,15H2,1-3H3,(H2,33,41)(H,35,37) |
| InChIKey | SMOSSVAEUSPNLT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|