C25H24F4N6O — CID 134288781
N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-(dimethylamino)phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide (PubChem CID 134288781) has the molecular formula C25H24F4N6O and a molecular weight of 500.50 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-(dimethylamino)phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-(dimethylamino)phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide |
|---|---|
| PubChem CID | 134288781 |
| Molecular Formula | C25H24F4N6O |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-(dimethylamino)phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide |
| SMILES | CN(C)c1ccc(C#Cc2ccc(C(F)(F)C(O)(CN(N)/C=N\N)c3ccc(F)cc3F)nc2)cc1 |
| InChI | InChI=1S/C25H24F4N6O/c1-34(2)20-9-5-17(6-10-20)3-4-18-7-12-23(32-14-18)25(28,29)24(36,15-35(31)16-33-30)21-11-8-19(26)13-22(21)27/h5-14,16,36H,15,30-31H2,1-2H3/b33-16- |
| InChIKey | KVWNRCUNFPAFFN-BJUCDSOZSA-N |
| XLogP | 2.88 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|