C22H20F5N5O2 — CID 135293331
N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-hydroxypropyl]methanimidamide (PubChem CID 135293331) has the molecular formula C22H20F5N5O2 and a molecular weight of 481.43 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-hydroxypropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-hydroxypropyl]methanimidamide |
|---|---|
| PubChem CID | 135293331 |
| Molecular Formula | C22H20F5N5O2 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-hydroxypropyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(OCc2cccc(F)c2)cn1 |
| InChI | InChI=1S/C22H20F5N5O2/c23-15-3-1-2-14(8-15)11-34-17-5-7-20(30-10-17)22(26,27)21(33,12-32(29)13-31-28)18-6-4-16(24)9-19(18)25/h1-10,13,33H,11-12,28-29H2/b31-13- |
| InChIKey | CQROEGBTPQCILA-AAPHRLRXSA-N |
| XLogP | 3.14 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|