C21H16F7N3O2 — CID 178082552
2-(2,4-difluorophenyl)-1,1-difluoro-3-hydrazinyl-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propan-2-ol (PubChem CID 178082552) has the molecular formula C21H16F7N3O2 and a molecular weight of 475.36 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-3-hydrazinyl-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-3-hydrazinyl-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 178082552 |
| Molecular Formula | C21H16F7N3O2 |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-3-hydrazinyl-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propan-2-ol |
| SMILES | NNCC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C21H16F7N3O2/c22-14-4-7-16(17(23)9-14)19(32,11-31-29)20(24,25)18-8-3-13(10-30-18)12-1-5-15(6-2-12)33-21(26,27)28/h1-10,31-32H,11,29H2 |
| InChIKey | BGWOBZIRLBUCII-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|