C23H15F7N4O4S — CID 171811700
[4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-pyridinyl]phenyl] trifluoromethanesulfonate (PubChem CID 171811700) has the molecular formula C23H15F7N4O4S and a molecular weight of 576.45 g/mol. Its IUPAC name is [4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-pyridinyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-pyridinyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171811700 |
| Molecular Formula | C23H15F7N4O4S |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | [4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-pyridinyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccc(C(F)(F)C(O)(Cn3cncn3)c3ccc(F)cc3F)nc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H15F7N4O4S/c24-16-4-7-18(19(25)9-16)21(35,11-34-13-31-12-33-34)22(26,27)20-8-3-15(10-32-20)14-1-5-17(6-2-14)38-39(36,37)23(28,29)30/h1-10,12-13,35H,11H2 |
| InChIKey | WLODYHCNZUAUBU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|