C23H14F7NO2 — CID 89347709
2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]pent-4-yn-2-ol (PubChem CID 89347709) has the molecular formula C23H14F7NO2 and a molecular weight of 469.36 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]pent-4-yn-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]pent-4-yn-2-ol |
|---|---|
| PubChem CID | 89347709 |
| Molecular Formula | C23H14F7NO2 |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]pent-4-yn-2-ol |
| SMILES | C#CCC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C23H14F7NO2/c1-2-11-21(32,18-9-6-16(24)12-19(18)25)22(26,27)20-10-5-15(13-31-20)14-3-7-17(8-4-14)33-23(28,29)30/h1,3-10,12-13,32H,11H2 |
| InChIKey | BHKFQBQRSYJVCY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|