C22H17F7N4O2 — CID 178082572
N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propyl]methanimidamide (PubChem CID 178082572) has the molecular formula C22H17F7N4O2 and a molecular weight of 502.39 g/mol. Its IUPAC name is N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propyl]methanimidamide.
| Compound Name | N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propyl]methanimidamide |
|---|---|
| PubChem CID | 178082572 |
| Molecular Formula | C22H17F7N4O2 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]propyl]methanimidamide |
| SMILES | NN/C=N/CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C22H17F7N4O2/c23-15-4-7-17(18(24)9-15)20(34,11-31-12-33-30)21(25,26)19-8-3-14(10-32-19)13-1-5-16(6-2-13)35-22(27,28)29/h1-10,12,34H,11,30H2,(H,31,33) |
| InChIKey | AOYSRAPLDGYTMR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|