C24H21F7N4O2 — CID 162564749
N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]-N-(methylamino)methanimidamide (PubChem CID 162564749) has the molecular formula C24H21F7N4O2 and a molecular weight of 530.44 g/mol. Its IUPAC name is N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]-N-(methylamino)methanimidamide.
| Compound Name | N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]-N-(methylamino)methanimidamide |
|---|---|
| PubChem CID | 162564749 |
| Molecular Formula | C24H21F7N4O2 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]-N-(methylamino)methanimidamide |
| SMILES | CNN/C=N/CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OCC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C24H21F7N4O2/c1-32-35-14-33-12-22(36,19-8-5-17(25)10-20(19)26)24(30,31)21-9-4-16(11-34-21)15-2-6-18(7-3-15)37-13-23(27,28)29/h2-11,14,32,36H,12-13H2,1H3,(H,33,35) |
| InChIKey | OUCUKHFTSIIYKM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|