C22H16F7N3O — CID 137427005
N'-[3-[5-[difluoro-(4-fluorophenyl)methyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide (PubChem CID 137427005) has the molecular formula C22H16F7N3O and a molecular weight of 471.38 g/mol. Its IUPAC name is N'-[3-[5-[difluoro-(4-fluorophenyl)methyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide.
| Compound Name | N'-[3-[5-[difluoro-(4-fluorophenyl)methyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
|---|---|
| PubChem CID | 137427005 |
| Molecular Formula | C22H16F7N3O |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N'-[3-[5-[difluoro-(4-fluorophenyl)methyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
| SMILES | N/C=N/CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(C(F)(F)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C22H16F7N3O/c23-15-4-1-13(2-5-15)21(26,27)14-3-8-19(32-10-14)22(28,29)20(33,11-31-12-30)17-7-6-16(24)9-18(17)25/h1-10,12,33H,11H2,(H2,30,31) |
| InChIKey | XJSSFNBOVBCEES-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|