C16H17F4N5O — CID 144927477
N,N'-diamino-N-[(2S)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide (PubChem CID 144927477) has the molecular formula C16H17F4N5O and a molecular weight of 371.34 g/mol. Its IUPAC name is N,N'-diamino-N-[(2S)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[(2S)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide |
|---|---|
| PubChem CID | 144927477 |
| Molecular Formula | C16H17F4N5O |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N,N'-diamino-N-[(2S)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide |
| SMILES | Cc1ccc(C(F)(F)[C@@](O)(CN(N)/C=N\N)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C16H17F4N5O/c1-10-2-5-14(23-7-10)16(19,20)15(26,8-25(22)9-24-21)12-4-3-11(17)6-13(12)18/h2-7,9,26H,8,21-22H2,1H3/b24-9-/t15-/m1/s1 |
| InChIKey | IWWZNGFQZVQICH-URUFLHFYSA-N |
| XLogP | 1.73 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|