C30H23F6N5O2 — CID 134288898
N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-[(2,3-difluorophenyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide (PubChem CID 134288898) has the molecular formula C30H23F6N5O2 and a molecular weight of 599.54 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-[(2,3-difluorophenyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-[(2,3-difluorophenyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide |
|---|---|
| PubChem CID | 134288898 |
| Molecular Formula | C30H23F6N5O2 |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3-[5-[2-[4-[(2,3-difluorophenyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccc(OCc3cccc(F)c3F)cc2)cn1 |
| InChI | InChI=1S/C30H23F6N5O2/c31-22-9-12-24(26(33)14-22)29(42,17-41(38)18-40-37)30(35,36)27-13-8-20(15-39-27)5-4-19-6-10-23(11-7-19)43-16-21-2-1-3-25(32)28(21)34/h1-3,6-15,18,42H,16-17,37-38H2/b40-18- |
| InChIKey | HHNGRIJLSBEVLX-POHGQRKGSA-N |
| XLogP | 4.67 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|