C24H17F5N6O — CID 134288810
N,N'-diamino-N-[3-[5-[2-(5-cyano-2-fluorophenyl)ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide (PubChem CID 134288810) has the molecular formula C24H17F5N6O and a molecular weight of 500.43 g/mol. Its IUPAC name is N,N'-diamino-N-[3-[5-[2-(5-cyano-2-fluorophenyl)ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-[5-[2-(5-cyano-2-fluorophenyl)ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
|---|---|
| PubChem CID | 134288810 |
| Molecular Formula | C24H17F5N6O |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | N,N'-diamino-N-[3-[5-[2-(5-cyano-2-fluorophenyl)ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
| SMILES | N#Cc1ccc(F)c(C#Cc2ccc(C(F)(F)C(O)(CN(N)/C=N\N)c3ccc(F)cc3F)nc2)c1 |
| InChI | InChI=1S/C24H17F5N6O/c25-18-5-6-19(21(27)10-18)23(36,13-35(32)14-34-31)24(28,29)22-8-3-15(12-33-22)1-4-17-9-16(11-30)2-7-20(17)26/h2-3,5-10,12,14,36H,13,31-32H2/b34-14- |
| InChIKey | XACOANSEOONCDN-PBEOLHQGSA-N |
| XLogP | 2.83 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|