C30H23F4N7O — CID 134288883
N,N'-diamino-N-[3-[5-[2-[4-[(5-cyano-2-pyridinyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide (PubChem CID 134288883) has the molecular formula C30H23F4N7O and a molecular weight of 573.55 g/mol. Its IUPAC name is N,N'-diamino-N-[3-[5-[2-[4-[(5-cyano-2-pyridinyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-[5-[2-[4-[(5-cyano-2-pyridinyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
|---|---|
| PubChem CID | 134288883 |
| Molecular Formula | C30H23F4N7O |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | N,N'-diamino-N-[3-[5-[2-[4-[(5-cyano-2-pyridinyl)methoxy]phenyl]ethynyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
| SMILES | N#Cc1ccc(COc2ccc(C#Cc3ccc(C(F)(F)C(CN(N)/C=N\N)c4ccc(F)cc4F)nc3)cc2)nc1 |
| InChI | InChI=1S/C30H23F4N7O/c31-23-7-11-26(28(32)13-23)27(17-41(37)19-40-36)30(33,34)29-12-6-21(15-39-29)2-1-20-4-9-25(10-5-20)42-18-24-8-3-22(14-35)16-38-24/h3-13,15-16,19,27H,17-18,36-37H2/b40-19- |
| InChIKey | AGLQWQROSFCDSX-WJMGCSMVSA-N |
| XLogP | 4.56 |
| TPSA | 126.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|