C23H19F5N6O — CID 135293348
N,N'-diamino-N-[3-[5-[(3-cyano-4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide (PubChem CID 135293348) has the molecular formula C23H19F5N6O and a molecular weight of 490.44 g/mol. Its IUPAC name is N,N'-diamino-N-[3-[5-[(3-cyano-4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-[5-[(3-cyano-4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
|---|---|
| PubChem CID | 135293348 |
| Molecular Formula | C23H19F5N6O |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N,N'-diamino-N-[3-[5-[(3-cyano-4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
| SMILES | N#Cc1cc(COc2ccc(C(F)(F)C(CN(N)/C=N\N)c3ccc(F)cc3F)nc2)ccc1F |
| InChI | InChI=1S/C23H19F5N6O/c24-16-2-4-18(21(26)8-16)19(11-34(31)13-33-30)23(27,28)22-6-3-17(10-32-22)35-12-14-1-5-20(25)15(7-14)9-29/h1-8,10,13,19H,11-12,30-31H2/b33-13- |
| InChIKey | VREZHHPDYNQGES-WWXMDWTASA-N |
| XLogP | 3.90 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|