C17H16ClF6N5O — CID 135293356
N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]propyl]methanimidamide (PubChem CID 135293356) has the molecular formula C17H16ClF6N5O and a molecular weight of 455.79 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]propyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]propyl]methanimidamide |
|---|---|
| PubChem CID | 135293356 |
| Molecular Formula | C17H16ClF6N5O |
| Molecular Weight | 455.79 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]propyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(c1ccc(Cl)cc1F)C(F)(F)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C17H16ClF6N5O/c18-10-1-3-12(14(19)5-10)13(7-29(26)9-28-25)17(23,24)15-4-2-11(6-27-15)30-8-16(20,21)22/h1-6,9,13H,7-8,25-26H2/b28-9- |
| InChIKey | QXEQPNCLDNUAEA-BMWVXGTQSA-N |
| XLogP | 3.77 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|