C23H21F5N4O — CID 135293467
N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-(2-fluoro-2-phenylethoxy)-2-pyridinyl]propyl]methanimidamide (PubChem CID 135293467) has the molecular formula C23H21F5N4O and a molecular weight of 464.44 g/mol. Its IUPAC name is N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-(2-fluoro-2-phenylethoxy)-2-pyridinyl]propyl]methanimidamide.
| Compound Name | N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-(2-fluoro-2-phenylethoxy)-2-pyridinyl]propyl]methanimidamide |
|---|---|
| PubChem CID | 135293467 |
| Molecular Formula | C23H21F5N4O |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-(2-fluoro-2-phenylethoxy)-2-pyridinyl]propyl]methanimidamide |
| SMILES | NN/C=N/CC(c1ccc(F)cc1F)C(F)(F)c1ccc(OCC(F)c2ccccc2)cn1 |
| InChI | InChI=1S/C23H21F5N4O/c24-16-6-8-18(20(25)10-16)19(12-30-14-32-29)23(27,28)22-9-7-17(11-31-22)33-13-21(26)15-4-2-1-3-5-15/h1-11,14,19,21H,12-13,29H2,(H,30,32) |
| InChIKey | HKPGGHXYZIDYJF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|