C19H21F4N5O — CID 137427029
N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-morpholin-4-yl-2-pyridinyl)propyl]methanimidamide (PubChem CID 137427029) has the molecular formula C19H21F4N5O and a molecular weight of 411.40 g/mol. Its IUPAC name is N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-morpholin-4-yl-2-pyridinyl)propyl]methanimidamide.
| Compound Name | N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-morpholin-4-yl-2-pyridinyl)propyl]methanimidamide |
|---|---|
| PubChem CID | 137427029 |
| Molecular Formula | C19H21F4N5O |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-amino-N'-[2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-morpholin-4-yl-2-pyridinyl)propyl]methanimidamide |
| SMILES | NN/C=N/CC(c1ccc(F)cc1F)C(F)(F)c1ccc(N2CCOCC2)cn1 |
| InChI | InChI=1S/C19H21F4N5O/c20-13-1-3-15(17(21)9-13)16(11-25-12-27-24)19(22,23)18-4-2-14(10-26-18)28-5-7-29-8-6-28/h1-4,9-10,12,16H,5-8,11,24H2,(H,25,27) |
| InChIKey | KTXAZAYMUVDBJY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|