C22H17F5N6O — CID 134592720
N,N'-diamino-N-[3-[5-(4-cyano-3-fluorophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide (PubChem CID 134592720) has the molecular formula C22H17F5N6O and a molecular weight of 476.41 g/mol. Its IUPAC name is N,N'-diamino-N-[3-[5-(4-cyano-3-fluorophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-[5-(4-cyano-3-fluorophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
|---|---|
| PubChem CID | 134592720 |
| Molecular Formula | C22H17F5N6O |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N,N'-diamino-N-[3-[5-(4-cyano-3-fluorophenoxy)-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
| SMILES | N#Cc1ccc(Oc2ccc(C(F)(F)C(CN(N)/C=N\N)c3ccc(F)cc3F)nc2)cc1F |
| InChI | InChI=1S/C22H17F5N6O/c23-14-2-5-17(20(25)7-14)18(11-33(30)12-32-29)22(26,27)21-6-4-16(10-31-21)34-15-3-1-13(9-28)19(24)8-15/h1-8,10,12,18H,11,29-30H2/b32-12- |
| InChIKey | DPWZRTJEEUXPKJ-ULTCEKQJSA-N |
| XLogP | 4.12 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|