C20H22F7N5O — CID 137427015
N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[3-(2,2,2-trifluoroethoxy)propyl]-2-pyridinyl]propyl]methanimidamide (PubChem CID 137427015) has the molecular formula C20H22F7N5O and a molecular weight of 481.42 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[3-(2,2,2-trifluoroethoxy)propyl]-2-pyridinyl]propyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[3-(2,2,2-trifluoroethoxy)propyl]-2-pyridinyl]propyl]methanimidamide |
|---|---|
| PubChem CID | 137427015 |
| Molecular Formula | C20H22F7N5O |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[3-(2,2,2-trifluoroethoxy)propyl]-2-pyridinyl]propyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(c1ccc(F)cc1F)C(F)(F)c1ccc(CCCOCC(F)(F)F)cn1 |
| InChI | InChI=1S/C20H22F7N5O/c21-14-4-5-15(17(22)8-14)16(10-32(29)12-31-28)20(26,27)18-6-3-13(9-30-18)2-1-7-33-11-19(23,24)25/h3-6,8-9,12,16H,1-2,7,10-11,28-29H2/b31-12- |
| InChIKey | ULCFFHGENJSUSY-HCNMGLPWSA-N |
| XLogP | 3.82 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|