C24H31F6N3O — CID 88951208
(3R)-N-[[5,6-bis(trifluoromethyl)-3-pyridinyl]methyl]-5-hexoxy-3-pyridin-2-ylpentan-1-amine (PubChem CID 88951208) has the molecular formula C24H31F6N3O and a molecular weight of 491.52 g/mol. Its IUPAC name is (3R)-N-[[5,6-bis(trifluoromethyl)-3-pyridinyl]methyl]-5-hexoxy-3-pyridin-2-ylpentan-1-amine.
| Compound Name | (3R)-N-[[5,6-bis(trifluoromethyl)-3-pyridinyl]methyl]-5-hexoxy-3-pyridin-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 88951208 |
| Molecular Formula | C24H31F6N3O |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (3R)-N-[[5,6-bis(trifluoromethyl)-3-pyridinyl]methyl]-5-hexoxy-3-pyridin-2-ylpentan-1-amine |
| SMILES | CCCCCCOCC[C@@H](CCNCc1cnc(C(F)(F)F)c(C(F)(F)F)c1)c1ccccn1 |
| InChI | InChI=1S/C24H31F6N3O/c1-2-3-4-7-13-34-14-10-19(21-8-5-6-11-32-21)9-12-31-16-18-15-20(23(25,26)27)22(33-17-18)24(28,29)30/h5-6,8,11,15,17,19,31H,2-4,7,9-10,12-14,16H2,1H3/t19-/m1/s1 |
| InChIKey | NQQKJIOKGOQZJY-LJQANCHMSA-N |
| XLogP | 6.76 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|