C28H30F3N5O3S — CID 142354805
butyl N-aminocarbamate;N-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-3,3-difluoro-2-(2-fluoro-4-methylphenyl)propyl]methanethioamide (PubChem CID 142354805) has the molecular formula C28H30F3N5O3S and a molecular weight of 573.64 g/mol. Its IUPAC name is butyl N-aminocarbamate;N-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-3,3-difluoro-2-(2-fluoro-4-methylphenyl)propyl]methanethioamide.
| Compound Name | butyl N-aminocarbamate;N-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-3,3-difluoro-2-(2-fluoro-4-methylphenyl)propyl]methanethioamide |
|---|---|
| PubChem CID | 142354805 |
| Molecular Formula | C28H30F3N5O3S |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | butyl N-aminocarbamate;N-[3-[5-(4-cyanophenoxy)-2-pyridinyl]-3,3-difluoro-2-(2-fluoro-4-methylphenyl)propyl]methanethioamide |
| SMILES | CCCCOC(=O)NN.Cc1ccc(C(CNC=S)C(F)(F)c2ccc(Oc3ccc(C#N)cc3)cn2)c(F)c1 |
| InChI | InChI=1S/C23H18F3N3OS.C5H12N2O2/c1-15-2-8-19(21(24)10-15)20(13-28-14-31)23(25,26)22-9-7-18(12-29-22)30-17-5-3-16(11-27)4-6-17;1-2-3-4-9-5(8)7-6/h2-10,12,14,20H,13H2,1H3,(H,28,31);2-4,6H2,1H3,(H,7,8) |
| InChIKey | KYLHYSXEFLKNMT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|