C15H15ClF3N5 — CID 137427028
N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-pyridin-2-ylpropyl]methanimidamide (PubChem CID 137427028) has the molecular formula C15H15ClF3N5 and a molecular weight of 357.77 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-pyridin-2-ylpropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-pyridin-2-ylpropyl]methanimidamide |
|---|---|
| PubChem CID | 137427028 |
| Molecular Formula | C15H15ClF3N5 |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N,N'-diamino-N-[2-(4-chloro-2-fluorophenyl)-3,3-difluoro-3-pyridin-2-ylpropyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(c1ccc(Cl)cc1F)C(F)(F)c1ccccn1 |
| InChI | InChI=1S/C15H15ClF3N5/c16-10-4-5-11(13(17)7-10)12(8-24(21)9-23-20)15(18,19)14-3-1-2-6-22-14/h1-7,9,12H,8,20-21H2/b23-9- |
| InChIKey | LPDKCDKQRWRVBH-AQHIEDMUSA-N |
| XLogP | 2.83 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|