C14H15Cl2F4N3O — CID 88594713
N-amino-N-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]-N'-ethenylmethanimidamide (PubChem CID 88594713) has the molecular formula C14H15Cl2F4N3O and a molecular weight of 388.19 g/mol. Its IUPAC name is N-amino-N-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]-N'-ethenylmethanimidamide.
| Compound Name | N-amino-N-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]-N'-ethenylmethanimidamide |
|---|---|
| PubChem CID | 88594713 |
| Molecular Formula | C14H15Cl2F4N3O |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-amino-N-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]-N'-ethenylmethanimidamide |
| SMILES | C=C/N=C/N(N)CC(COC(F)(F)C(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2F4N3O/c1-2-22-8-23(21)6-9(7-24-14(19,20)13(17)18)11-4-3-10(15)5-12(11)16/h2-5,8-9,13H,1,6-7,21H2/b22-8+ |
| InChIKey | LJCKVPFKNWGUCG-GZIVZEMBSA-N |
| XLogP | 4.30 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|