C31H25F3N4O — CID 155000433
4-[[4-[2-[6-[1,1-difluoro-2-(4-fluoro-2-methylphenyl)-3-hydrazinylpropyl]-3-pyridinyl]ethynyl]phenoxy]methyl]benzonitrile (PubChem CID 155000433) has the molecular formula C31H25F3N4O and a molecular weight of 526.56 g/mol. Its IUPAC name is 4-[[4-[2-[6-[1,1-difluoro-2-(4-fluoro-2-methylphenyl)-3-hydrazinylpropyl]-3-pyridinyl]ethynyl]phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-[6-[1,1-difluoro-2-(4-fluoro-2-methylphenyl)-3-hydrazinylpropyl]-3-pyridinyl]ethynyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 155000433 |
| Molecular Formula | C31H25F3N4O |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 4-[[4-[2-[6-[1,1-difluoro-2-(4-fluoro-2-methylphenyl)-3-hydrazinylpropyl]-3-pyridinyl]ethynyl]phenoxy]methyl]benzonitrile |
| SMILES | Cc1cc(F)ccc1C(CNN)C(F)(F)c1ccc(C#Cc2ccc(OCc3ccc(C#N)cc3)cc2)cn1 |
| InChI | InChI=1S/C31H25F3N4O/c1-21-16-26(32)11-14-28(21)29(19-38-36)31(33,34)30-15-10-24(18-37-30)5-2-22-8-12-27(13-9-22)39-20-25-6-3-23(17-35)4-7-25/h3-4,6-16,18,29,38H,19-20,36H2,1H3 |
| InChIKey | XNMAQPOFUIIHOD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|