C23H16F7N5O3 — CID 134288867
N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)furan-2-yl]ethynyl]-2-pyridinyl]propyl]-N-hydrazinylidenemethanimidamide (PubChem CID 134288867) has the molecular formula C23H16F7N5O3 and a molecular weight of 543.40 g/mol. Its IUPAC name is N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)furan-2-yl]ethynyl]-2-pyridinyl]propyl]-N-hydrazinylidenemethanimidamide.
| Compound Name | N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)furan-2-yl]ethynyl]-2-pyridinyl]propyl]-N-hydrazinylidenemethanimidamide |
|---|---|
| PubChem CID | 134288867 |
| Molecular Formula | C23H16F7N5O3 |
| Molecular Weight | 543.40 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | N'-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)furan-2-yl]ethynyl]-2-pyridinyl]propyl]-N-hydrazinylidenemethanimidamide |
| SMILES | N/N=N/C=N/CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccc(C(O)C(F)(F)F)o2)cn1 |
| InChI | InChI=1S/C23H16F7N5O3/c24-14-3-6-16(17(25)9-14)21(37,11-32-12-34-35-31)22(26,27)19-8-2-13(10-33-19)1-4-15-5-7-18(38-15)20(36)23(28,29)30/h2-3,5-10,12,20,36-37H,11H2,(H2,31,32,34) |
| InChIKey | YECUIOAUOFJLIF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|