C23H16F7N5O2S — CID 162570377
2-(2,4-difluorophenyl)-3-(2,3-dihydrotetrazol-1-yl)-1,1-difluoro-1-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)thiophen-2-yl]ethynyl]-2-pyridinyl]propan-2-ol (PubChem CID 162570377) has the molecular formula C23H16F7N5O2S and a molecular weight of 559.47 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-(2,3-dihydrotetrazol-1-yl)-1,1-difluoro-1-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)thiophen-2-yl]ethynyl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-3-(2,3-dihydrotetrazol-1-yl)-1,1-difluoro-1-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)thiophen-2-yl]ethynyl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 162570377 |
| Molecular Formula | C23H16F7N5O2S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-(2,3-dihydrotetrazol-1-yl)-1,1-difluoro-1-[5-[2-[5-(2,2,2-trifluoro-1-hydroxyethyl)thiophen-2-yl]ethynyl]-2-pyridinyl]propan-2-ol |
| SMILES | OC(c1ccc(C#Cc2ccc(C(F)(F)C(O)(CN3C=NNN3)c3ccc(F)cc3F)nc2)s1)C(F)(F)F |
| InChI | InChI=1S/C23H16F7N5O2S/c24-14-3-6-16(17(25)9-14)21(37,11-35-12-32-33-34-35)22(26,27)19-8-2-13(10-31-19)1-4-15-5-7-18(38-15)20(36)23(28,29)30/h2-3,5-10,12,20,33-34,36-37H,11H2 |
| InChIKey | QZAFCXMBFBDHFV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|