C19H15F4N5O2 — CID 71621943
4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]but-3-yn-2-ol (PubChem CID 71621943) has the molecular formula C19H15F4N5O2 and a molecular weight of 421.35 g/mol. Its IUPAC name is 4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]but-3-yn-2-ol.
| Compound Name | 4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 71621943 |
| Molecular Formula | C19H15F4N5O2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]but-3-yn-2-ol |
| SMILES | CC(O)C#Cc1ccc(C(F)(F)C(O)(Cn2cnnn2)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C19H15F4N5O2/c1-12(29)2-3-13-4-7-17(24-9-13)19(22,23)18(30,10-28-11-25-26-27-28)15-6-5-14(20)8-16(15)21/h4-9,11-12,29-30H,10H2,1H3 |
| InChIKey | XLJNXGRBROLHLK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|