C21H23F4N5O2 — CID 71143730
2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(3-propan-2-yloxypropyl)-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol (PubChem CID 71143730) has the molecular formula C21H23F4N5O2 and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(3-propan-2-yloxypropyl)-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(3-propan-2-yloxypropyl)-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 71143730 |
| Molecular Formula | C21H23F4N5O2 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(3-propan-2-yloxypropyl)-2-pyridinyl]-3-(tetrazol-1-yl)propan-2-ol |
| SMILES | CC(C)OCCCc1ccc(C(F)(F)C(O)(Cn2cnnn2)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C21H23F4N5O2/c1-14(2)32-9-3-4-15-5-8-19(26-11-15)21(24,25)20(31,12-30-13-27-28-29-30)17-7-6-16(22)10-18(17)23/h5-8,10-11,13-14,31H,3-4,9,12H2,1-2H3 |
| InChIKey | FEHCIDFDLPRTIN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|